C9H17N5O4S — CID 106233760
2-[2-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonylamino]ethoxy]acetamide (PubChem CID 106233760) has the molecular formula C9H17N5O4S and a molecular weight of 291.33 g/mol. Its IUPAC name is 2-[2-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonylamino]ethoxy]acetamide.
| Compound Name | 2-[2-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonylamino]ethoxy]acetamide |
|---|---|
| PubChem CID | 106233760 |
| Molecular Formula | C9H17N5O4S |
| Molecular Weight | 291.33 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | 2-[2-[(3-amino-1,5-dimethylpyrazol-4-yl)sulfonylamino]ethoxy]acetamide |
| SMILES | Cc1c(S(=O)(=O)NCCOCC(N)=O)c(N)nn1C |
| InChI | InChI=1S/C9H17N5O4S/c1-6-8(9(11)13-14(6)2)19(16,17)12-3-4-18-5-7(10)15/h12H,3-5H2,1-2H3,(H2,10,15)(H2,11,13) |
| InChIKey | WBNNBLQXZYSWAK-UHFFFAOYSA-N |
| XLogP | -1.91 |
| TPSA | 142.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.33 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|