C11H12FN3O2S2 — CID 63238706
2-amino-6-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide (PubChem CID 63238706) has the molecular formula C11H12FN3O2S2 and a molecular weight of 301.37 g/mol. Its IUPAC name is 2-amino-6-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide.
| Compound Name | 2-amino-6-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63238706 |
| Molecular Formula | C11H12FN3O2S2 |
| Molecular Weight | 301.37 g/mol |
| Exact Mass | 301.04 |
| IUPAC Name | 2-amino-6-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzenesulfonamide |
| SMILES | Nc1cccc(F)c1S(=O)(=O)NCCc1nccs1 |
| InChI | InChI=1S/C11H12FN3O2S2/c12-8-2-1-3-9(13)11(8)19(16,17)15-5-4-10-14-6-7-18-10/h1-3,6-7,15H,4-5,13H2 |
| InChIKey | XUURQOCPXKVCTC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.37 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|