C10H10FN3O3S — CID 114185734
2-amino-6-fluoro-N-(1,2-oxazol-5-ylmethyl)benzenesulfonamide (PubChem CID 114185734) has the molecular formula C10H10FN3O3S and a molecular weight of 271.27 g/mol. Its IUPAC name is 2-amino-6-fluoro-N-(1,2-oxazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 2-amino-6-fluoro-N-(1,2-oxazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 114185734 |
| Molecular Formula | C10H10FN3O3S |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.04 |
| IUPAC Name | 2-amino-6-fluoro-N-(1,2-oxazol-5-ylmethyl)benzenesulfonamide |
| SMILES | Nc1cccc(F)c1S(=O)(=O)NCc1ccno1 |
| InChI | InChI=1S/C10H10FN3O3S/c11-8-2-1-3-9(12)10(8)18(15,16)14-6-7-4-5-13-17-7/h1-5,14H,6,12H2 |
| InChIKey | RXNOLECXJPPDDI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|