C12H14FN3O3S — CID 79225534
2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-6-fluorobenzenesulfonamide (PubChem CID 79225534) has the molecular formula C12H14FN3O3S and a molecular weight of 299.33 g/mol. Its IUPAC name is 2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-6-fluorobenzenesulfonamide.
| Compound Name | 2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-6-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 79225534 |
| Molecular Formula | C12H14FN3O3S |
| Molecular Weight | 299.33 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-6-fluorobenzenesulfonamide |
| SMILES | Cc1noc(C)c1CNS(=O)(=O)c1c(N)cccc1F |
| InChI | InChI=1S/C12H14FN3O3S/c1-7-9(8(2)19-16-7)6-15-20(17,18)12-10(13)4-3-5-11(12)14/h3-5,15H,6,14H2,1-2H3 |
| InChIKey | FZABDPJLNOAYQI-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.33 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|