C12H13F2N3O3S — CID 79223521
4-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,6-difluorobenzenesulfonamide (PubChem CID 79223521) has the molecular formula C12H13F2N3O3S and a molecular weight of 317.32 g/mol. Its IUPAC name is 4-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,6-difluorobenzenesulfonamide.
| Compound Name | 4-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,6-difluorobenzenesulfonamide |
|---|---|
| PubChem CID | 79223521 |
| Molecular Formula | C12H13F2N3O3S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 4-amino-N-[(3,5-dimethyl-1,2-oxazol-4-yl)methyl]-2,6-difluorobenzenesulfonamide |
| SMILES | Cc1noc(C)c1CNS(=O)(=O)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C12H13F2N3O3S/c1-6-9(7(2)20-17-6)5-16-21(18,19)12-10(13)3-8(15)4-11(12)14/h3-4,16H,5,15H2,1-2H3 |
| InChIKey | VECBDOLQWVYPAQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|