C12H11ClF2N2O3S — CID 3829002
N-[(3-chloro-2,6-difluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide (PubChem CID 3829002) has the molecular formula C12H11ClF2N2O3S and a molecular weight of 336.75 g/mol. Its IUPAC name is N-[(3-chloro-2,6-difluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide.
| Compound Name | N-[(3-chloro-2,6-difluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
|---|---|
| PubChem CID | 3829002 |
| Molecular Formula | C12H11ClF2N2O3S |
| Molecular Weight | 336.75 g/mol |
| Exact Mass | 336.01 |
| IUPAC Name | N-[(3-chloro-2,6-difluorophenyl)methyl]-3,5-dimethyl-1,2-oxazole-4-sulfonamide |
| SMILES | Cc1noc(C)c1S(=O)(=O)NCc1c(F)ccc(Cl)c1F |
| InChI | InChI=1S/C12H11ClF2N2O3S/c1-6-12(7(2)20-17-6)21(18,19)16-5-8-10(14)4-3-9(13)11(8)15/h3-4,16H,5H2,1-2H3 |
| InChIKey | SHXKBESZSJVKBQ-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.75 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|