C11H11F2N3O2S2 — CID 63280248
4-amino-2,6-difluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzenesulfonamide (PubChem CID 63280248) has the molecular formula C11H11F2N3O2S2 and a molecular weight of 319.36 g/mol. Its IUPAC name is 4-amino-2,6-difluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzenesulfonamide.
| Compound Name | 4-amino-2,6-difluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 63280248 |
| Molecular Formula | C11H11F2N3O2S2 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | 4-amino-2,6-difluoro-N-[(4-methyl-1,3-thiazol-5-yl)methyl]benzenesulfonamide |
| SMILES | Cc1ncsc1CNS(=O)(=O)c1c(F)cc(N)cc1F |
| InChI | InChI=1S/C11H11F2N3O2S2/c1-6-10(19-5-15-6)4-16-20(17,18)11-8(12)2-7(14)3-9(11)13/h2-3,5,16H,4,14H2,1H3 |
| InChIKey | FYAJKPLFYTVJRK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|