C10H9F2N3O3S — CID 106413925
5-amino-2,4-difluoro-N-(1,2-oxazol-5-ylmethyl)benzenesulfonamide (PubChem CID 106413925) has the molecular formula C10H9F2N3O3S and a molecular weight of 289.26 g/mol. Its IUPAC name is 5-amino-2,4-difluoro-N-(1,2-oxazol-5-ylmethyl)benzenesulfonamide.
| Compound Name | 5-amino-2,4-difluoro-N-(1,2-oxazol-5-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 106413925 |
| Molecular Formula | C10H9F2N3O3S |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | 5-amino-2,4-difluoro-N-(1,2-oxazol-5-ylmethyl)benzenesulfonamide |
| SMILES | Nc1cc(S(=O)(=O)NCc2ccno2)c(F)cc1F |
| InChI | InChI=1S/C10H9F2N3O3S/c11-7-3-8(12)10(4-9(7)13)19(16,17)15-5-6-1-2-14-18-6/h1-4,15H,5,13H2 |
| InChIKey | CEDPMRGBGUGQSL-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|