C11H10ClN3O3S2 — CID 106418008
3-chloro-4-(1,2-oxazol-5-ylmethylsulfamoyl)benzenecarbothioamide (PubChem CID 106418008) has the molecular formula C11H10ClN3O3S2 and a molecular weight of 331.81 g/mol. Its IUPAC name is 3-chloro-4-(1,2-oxazol-5-ylmethylsulfamoyl)benzenecarbothioamide.
| Compound Name | 3-chloro-4-(1,2-oxazol-5-ylmethylsulfamoyl)benzenecarbothioamide |
|---|---|
| PubChem CID | 106418008 |
| Molecular Formula | C11H10ClN3O3S2 |
| Molecular Weight | 331.81 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | 3-chloro-4-(1,2-oxazol-5-ylmethylsulfamoyl)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(S(=O)(=O)NCc2ccno2)c(Cl)c1 |
| InChI | InChI=1S/C11H10ClN3O3S2/c12-9-5-7(11(13)19)1-2-10(9)20(16,17)15-6-8-3-4-14-18-8/h1-5,15H,6H2,(H2,13,19) |
| InChIKey | JTDUSXGVGVXHTE-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.81 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|