C12H14N4O3S — CID 116786572
1-[3-(aminomethyl)phenyl]-N-(6-oxo-1H-pyridazin-3-yl)methanesulfonamide (PubChem CID 116786572) has the molecular formula C12H14N4O3S and a molecular weight of 294.34 g/mol. Its IUPAC name is 1-[3-(aminomethyl)phenyl]-N-(6-oxo-1H-pyridazin-3-yl)methanesulfonamide.
| Compound Name | 1-[3-(aminomethyl)phenyl]-N-(6-oxo-1H-pyridazin-3-yl)methanesulfonamide |
|---|---|
| PubChem CID | 116786572 |
| Molecular Formula | C12H14N4O3S |
| Molecular Weight | 294.34 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 1-[3-(aminomethyl)phenyl]-N-(6-oxo-1H-pyridazin-3-yl)methanesulfonamide |
| SMILES | NCc1cccc(CS(=O)(=O)Nc2ccc(=O)[nH]n2)c1 |
| InChI | InChI=1S/C12H14N4O3S/c13-7-9-2-1-3-10(6-9)8-20(18,19)16-11-4-5-12(17)15-14-11/h1-6H,7-8,13H2,(H,14,16)(H,15,17) |
| InChIKey | GHYUWGDNWWCIAV-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.34 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |