C7H12N4O3S — CID 116786583
1-amino-N-(6-oxo-1H-pyridazin-3-yl)propane-2-sulfonamide (PubChem CID 116786583) has the molecular formula C7H12N4O3S and a molecular weight of 232.27 g/mol. Its IUPAC name is 1-amino-N-(6-oxo-1H-pyridazin-3-yl)propane-2-sulfonamide.
| Compound Name | 1-amino-N-(6-oxo-1H-pyridazin-3-yl)propane-2-sulfonamide |
|---|---|
| PubChem CID | 116786583 |
| Molecular Formula | C7H12N4O3S |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | 1-amino-N-(6-oxo-1H-pyridazin-3-yl)propane-2-sulfonamide |
| SMILES | CC(CN)S(=O)(=O)Nc1ccc(=O)[nH]n1 |
| InChI | InChI=1S/C7H12N4O3S/c1-5(4-8)15(13,14)11-6-2-3-7(12)10-9-6/h2-3,5H,4,8H2,1H3,(H,9,11)(H,10,12) |
| InChIKey | FBFNEDMNRBKRBL-UHFFFAOYSA-N |
| XLogP | -1.14 |
| TPSA | 117.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | -1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |