C6H8ClN3O3S — CID 107652538
2-chloro-N-(6-oxo-1H-pyridazin-3-yl)ethanesulfonamide (PubChem CID 107652538) has the molecular formula C6H8ClN3O3S and a molecular weight of 237.67 g/mol. Its IUPAC name is 2-chloro-N-(6-oxo-1H-pyridazin-3-yl)ethanesulfonamide.
| Compound Name | 2-chloro-N-(6-oxo-1H-pyridazin-3-yl)ethanesulfonamide |
|---|---|
| PubChem CID | 107652538 |
| Molecular Formula | C6H8ClN3O3S |
| Molecular Weight | 237.67 g/mol |
| Exact Mass | 237.00 |
| IUPAC Name | 2-chloro-N-(6-oxo-1H-pyridazin-3-yl)ethanesulfonamide |
| SMILES | O=c1ccc(NS(=O)(=O)CCCl)n[nH]1 |
| InChI | InChI=1S/C6H8ClN3O3S/c7-3-4-14(12,13)10-5-1-2-6(11)9-8-5/h1-2H,3-4H2,(H,8,10)(H,9,11) |
| InChIKey | FIBOWHWYLXYDHN-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.67 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|