C21H28N2O4 — CID 110351255
(2S)-N-(furan-2-ylmethyl)-4-methyl-2-(4-phenoxybutanoylamino)pentanamide (PubChem CID 110351255) has the molecular formula C21H28N2O4 and a molecular weight of 372.47 g/mol. Its IUPAC name is (2S)-N-(furan-2-ylmethyl)-4-methyl-2-(4-phenoxybutanoylamino)pentanamide.
| Compound Name | (2S)-N-(furan-2-ylmethyl)-4-methyl-2-(4-phenoxybutanoylamino)pentanamide |
|---|---|
| PubChem CID | 110351255 |
| Molecular Formula | C21H28N2O4 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | (2S)-N-(furan-2-ylmethyl)-4-methyl-2-(4-phenoxybutanoylamino)pentanamide |
| SMILES | CC(C)C[C@H](NC(=O)CCCOc1ccccc1)C(=O)NCc1ccco1 |
| InChI | InChI=1S/C21H28N2O4/c1-16(2)14-19(21(25)22-15-18-10-6-12-27-18)23-20(24)11-7-13-26-17-8-4-3-5-9-17/h3-6,8-10,12,16,19H,7,11,13-15H2,1-2H3,(H,22,25)(H,23,24)/t19-/m0/s1 |
| InChIKey | FJTBFSXUFUPPMB-IBGZPJMESA-N |
| XLogP | 3.29 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|