C14H22N2O4 — CID 60692657
methyl 2-[[2-(furan-2-ylmethylamino)-2-oxoethyl]amino]-4-methylpentanoate (PubChem CID 60692657) has the molecular formula C14H22N2O4 and a molecular weight of 282.34 g/mol. Its IUPAC name is methyl 2-[[2-(furan-2-ylmethylamino)-2-oxoethyl]amino]-4-methylpentanoate.
| Compound Name | methyl 2-[[2-(furan-2-ylmethylamino)-2-oxoethyl]amino]-4-methylpentanoate |
|---|---|
| PubChem CID | 60692657 |
| Molecular Formula | C14H22N2O4 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | methyl 2-[[2-(furan-2-ylmethylamino)-2-oxoethyl]amino]-4-methylpentanoate |
| SMILES | COC(=O)C(CC(C)C)NCC(=O)NCc1ccco1 |
| InChI | InChI=1S/C14H22N2O4/c1-10(2)7-12(14(18)19-3)15-9-13(17)16-8-11-5-4-6-20-11/h4-6,10,12,15H,7-9H2,1-3H3,(H,16,17) |
| InChIKey | XTLFULFEWASEGD-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |