C10H14N2O4 — CID 4265713
methyl 2-(furan-2-ylmethylcarbamoylamino)propanoate (PubChem CID 4265713) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is methyl 2-(furan-2-ylmethylcarbamoylamino)propanoate.
| Compound Name | methyl 2-(furan-2-ylmethylcarbamoylamino)propanoate |
|---|---|
| PubChem CID | 4265713 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | methyl 2-(furan-2-ylmethylcarbamoylamino)propanoate |
| SMILES | COC(=O)C(C)NC(=O)NCc1ccco1 |
| InChI | InChI=1S/C10H14N2O4/c1-7(9(13)15-2)12-10(14)11-6-8-4-3-5-16-8/h3-5,7H,6H2,1-2H3,(H2,11,12,14) |
| InChIKey | AUPUZZVVHAVYGQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |