C16H20N2O4S — CID 99823433
1-(furan-2-ylmethyl)-3-[(2S)-1-(4-methylphenyl)sulfonylpropan-2-yl]urea (PubChem CID 99823433) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[(2S)-1-(4-methylphenyl)sulfonylpropan-2-yl]urea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[(2S)-1-(4-methylphenyl)sulfonylpropan-2-yl]urea |
|---|---|
| PubChem CID | 99823433 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[(2S)-1-(4-methylphenyl)sulfonylpropan-2-yl]urea |
| SMILES | Cc1ccc(S(=O)(=O)C[C@H](C)NC(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C16H20N2O4S/c1-12-5-7-15(8-6-12)23(20,21)11-13(2)18-16(19)17-10-14-4-3-9-22-14/h3-9,13H,10-11H2,1-2H3,(H2,17,18,19)/t13-/m0/s1 |
| InChIKey | DACAEYIZEWFYAY-ZDUSSCGKSA-N |
| XLogP | 2.25 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |