C14H16O3S — CID 134965233
2-[(2S)-1-(4-methylphenyl)sulfonylpropan-2-yl]furan (PubChem CID 134965233) has the molecular formula C14H16O3S and a molecular weight of 264.35 g/mol. Its IUPAC name is 2-[(2S)-1-(4-methylphenyl)sulfonylpropan-2-yl]furan.
| Compound Name | 2-[(2S)-1-(4-methylphenyl)sulfonylpropan-2-yl]furan |
|---|---|
| PubChem CID | 134965233 |
| Molecular Formula | C14H16O3S |
| Molecular Weight | 264.35 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | 2-[(2S)-1-(4-methylphenyl)sulfonylpropan-2-yl]furan |
| SMILES | Cc1ccc(S(=O)(=O)C[C@@H](C)c2ccco2)cc1 |
| InChI | InChI=1S/C14H16O3S/c1-11-5-7-13(8-6-11)18(15,16)10-12(2)14-4-3-9-17-14/h3-9,12H,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | PJQKDSNXVJKVCF-GFCCVEGCSA-N |
| XLogP | 3.17 |
| TPSA | 47.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.35 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |