C18H20O4S — CID 58417517
2-hydroxy-1-[3-[(2R)-1-(4-methylphenyl)sulfonylpropan-2-yl]phenyl]ethanone (PubChem CID 58417517) has the molecular formula C18H20O4S and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-hydroxy-1-[3-[(2R)-1-(4-methylphenyl)sulfonylpropan-2-yl]phenyl]ethanone.
| Compound Name | 2-hydroxy-1-[3-[(2R)-1-(4-methylphenyl)sulfonylpropan-2-yl]phenyl]ethanone |
|---|---|
| PubChem CID | 58417517 |
| Molecular Formula | C18H20O4S |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 2-hydroxy-1-[3-[(2R)-1-(4-methylphenyl)sulfonylpropan-2-yl]phenyl]ethanone |
| SMILES | Cc1ccc(S(=O)(=O)C[C@H](C)c2cccc(C(=O)CO)c2)cc1 |
| InChI | InChI=1S/C18H20O4S/c1-13-6-8-17(9-7-13)23(21,22)12-14(2)15-4-3-5-16(10-15)18(20)11-19/h3-10,14,19H,11-12H2,1-2H3/t14-/m0/s1 |
| InChIKey | MMZIGIVLSJMUHJ-AWEZNQCLSA-N |
| XLogP | 2.75 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |