C10H14N2O5 — CID 106109550
3-(furan-2-ylmethylcarbamoylamino)-2-methoxypropanoic acid (PubChem CID 106109550) has the molecular formula C10H14N2O5 and a molecular weight of 242.23 g/mol. Its IUPAC name is 3-(furan-2-ylmethylcarbamoylamino)-2-methoxypropanoic acid.
| Compound Name | 3-(furan-2-ylmethylcarbamoylamino)-2-methoxypropanoic acid |
|---|---|
| PubChem CID | 106109550 |
| Molecular Formula | C10H14N2O5 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | 3-(furan-2-ylmethylcarbamoylamino)-2-methoxypropanoic acid |
| SMILES | COC(CNC(=O)NCc1ccco1)C(=O)O |
| InChI | InChI=1S/C10H14N2O5/c1-16-8(9(13)14)6-12-10(15)11-5-7-3-2-4-17-7/h2-4,8H,5-6H2,1H3,(H,13,14)(H2,11,12,15) |
| InChIKey | LTDIGLYETFIANP-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |