C11H18N2O3 — CID 111470946
1-(furan-2-ylmethyl)-3-(4-hydroxy-2-methylbutyl)urea (PubChem CID 111470946) has the molecular formula C11H18N2O3 and a molecular weight of 226.28 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-(4-hydroxy-2-methylbutyl)urea.
| Compound Name | 1-(furan-2-ylmethyl)-3-(4-hydroxy-2-methylbutyl)urea |
|---|---|
| PubChem CID | 111470946 |
| Molecular Formula | C11H18N2O3 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.13 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-(4-hydroxy-2-methylbutyl)urea |
| SMILES | CC(CCO)CNC(=O)NCc1ccco1 |
| InChI | InChI=1S/C11H18N2O3/c1-9(4-5-14)7-12-11(15)13-8-10-3-2-6-16-10/h2-3,6,9,14H,4-5,7-8H2,1H3,(H2,12,13,15) |
| InChIKey | VIQQDOYMGOABGC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |