C14H24N2O3 — CID 111499070
1-(2,2-diethyl-4-hydroxybutyl)-3-(furan-2-ylmethyl)urea (PubChem CID 111499070) has the molecular formula C14H24N2O3 and a molecular weight of 268.36 g/mol. Its IUPAC name is 1-(2,2-diethyl-4-hydroxybutyl)-3-(furan-2-ylmethyl)urea.
| Compound Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-(furan-2-ylmethyl)urea |
|---|---|
| PubChem CID | 111499070 |
| Molecular Formula | C14H24N2O3 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | 1-(2,2-diethyl-4-hydroxybutyl)-3-(furan-2-ylmethyl)urea |
| SMILES | CCC(CC)(CCO)CNC(=O)NCc1ccco1 |
| InChI | InChI=1S/C14H24N2O3/c1-3-14(4-2,7-8-17)11-16-13(18)15-10-12-6-5-9-19-12/h5-6,9,17H,3-4,7-8,10-11H2,1-2H3,(H2,15,16,18) |
| InChIKey | XGLIKMFIHYEEGF-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |