C16H25ClN2O2 — CID 111499071
1-[(4-chlorophenyl)methyl]-3-(2,2-diethyl-4-hydroxybutyl)urea (PubChem CID 111499071) has the molecular formula C16H25ClN2O2 and a molecular weight of 312.84 g/mol. Its IUPAC name is 1-[(4-chlorophenyl)methyl]-3-(2,2-diethyl-4-hydroxybutyl)urea.
| Compound Name | 1-[(4-chlorophenyl)methyl]-3-(2,2-diethyl-4-hydroxybutyl)urea |
|---|---|
| PubChem CID | 111499071 |
| Molecular Formula | C16H25ClN2O2 |
| Molecular Weight | 312.84 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | 1-[(4-chlorophenyl)methyl]-3-(2,2-diethyl-4-hydroxybutyl)urea |
| SMILES | CCC(CC)(CCO)CNC(=O)NCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H25ClN2O2/c1-3-16(4-2,9-10-20)12-19-15(21)18-11-13-5-7-14(17)8-6-13/h5-8,20H,3-4,9-12H2,1-2H3,(H2,18,19,21) |
| InChIKey | UHEXHYUQGCHSJU-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.84 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |