C22H28N2O5S — CID 110824061
2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethanone (PubChem CID 110824061) has the molecular formula C22H28N2O5S and a molecular weight of 432.54 g/mol. Its IUPAC name is 2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethanone.
| Compound Name | 2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethanone |
|---|---|
| PubChem CID | 110824061 |
| Molecular Formula | C22H28N2O5S |
| Molecular Weight | 432.54 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | 2-[2-(3,4-dimethoxyphenyl)ethylamino]-1-(4-pyrrolidin-1-ylsulfonylphenyl)ethanone |
| SMILES | COc1ccc(CCNCC(=O)c2ccc(S(=O)(=O)N3CCCC3)cc2)cc1OC |
| InChI | InChI=1S/C22H28N2O5S/c1-28-21-10-5-17(15-22(21)29-2)11-12-23-16-20(25)18-6-8-19(9-7-18)30(26,27)24-13-3-4-14-24/h5-10,15,23H,3-4,11-14,16H2,1-2H3 |
| InChIKey | AEYZPFALLIWOCG-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.54 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|