C15H16I3N3O2 — CID 19777517
2,4,6-triiodo-5-(methylamino)-1-N,3-N-bis(prop-2-enyl)benzene-1,3-dicarboxamide (PubChem CID 19777517) has the molecular formula C15H16I3N3O2 and a molecular weight of 651.02 g/mol. Its IUPAC name is 2,4,6-triiodo-5-(methylamino)-1-N,3-N-bis(prop-2-enyl)benzene-1,3-dicarboxamide.
| Compound Name | 2,4,6-triiodo-5-(methylamino)-1-N,3-N-bis(prop-2-enyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 19777517 |
| Molecular Formula | C15H16I3N3O2 |
| Molecular Weight | 651.02 g/mol |
| Exact Mass | 650.84 |
| IUPAC Name | 2,4,6-triiodo-5-(methylamino)-1-N,3-N-bis(prop-2-enyl)benzene-1,3-dicarboxamide |
| SMILES | C=CCNC(=O)c1c(I)c(NC)c(I)c(C(=O)NCC=C)c1I |
| InChI | InChI=1S/C15H16I3N3O2/c1-4-6-20-14(22)8-10(16)9(15(23)21-7-5-2)12(18)13(19-3)11(8)17/h4-5,19H,1-2,6-7H2,3H3,(H,20,22)(H,21,23) |
| InChIKey | JWTPNOIMQWVDPG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.02 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|