C10H8I3NO3 — CID 150214278
3-acetyl-2,4,6-triiodo-5-(methylamino)benzoic acid (PubChem CID 150214278) has the molecular formula C10H8I3NO3 and a molecular weight of 570.89 g/mol. Its IUPAC name is 3-acetyl-2,4,6-triiodo-5-(methylamino)benzoic acid.
| Compound Name | 3-acetyl-2,4,6-triiodo-5-(methylamino)benzoic acid |
|---|---|
| PubChem CID | 150214278 |
| Molecular Formula | C10H8I3NO3 |
| Molecular Weight | 570.89 g/mol |
| Exact Mass | 570.76 |
| IUPAC Name | 3-acetyl-2,4,6-triiodo-5-(methylamino)benzoic acid |
| SMILES | CNc1c(I)c(C(C)=O)c(I)c(C(=O)O)c1I |
| InChI | InChI=1S/C10H8I3NO3/c1-3(15)4-6(11)5(10(16)17)8(13)9(14-2)7(4)12/h14H,1-2H3,(H,16,17) |
| InChIKey | FSDHOILXGOQGTG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.89 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|