C12H12I3NO6 — CID 175542639
5-(1,1-dimethoxyethylamino)-2,4,6-triiodobenzene-1,3-dicarboxylic acid (PubChem CID 175542639) has the molecular formula C12H12I3NO6 and a molecular weight of 646.94 g/mol. Its IUPAC name is 5-(1,1-dimethoxyethylamino)-2,4,6-triiodobenzene-1,3-dicarboxylic acid.
| Compound Name | 5-(1,1-dimethoxyethylamino)-2,4,6-triiodobenzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 175542639 |
| Molecular Formula | C12H12I3NO6 |
| Molecular Weight | 646.94 g/mol |
| Exact Mass | 646.78 |
| IUPAC Name | 5-(1,1-dimethoxyethylamino)-2,4,6-triiodobenzene-1,3-dicarboxylic acid |
| SMILES | COC(C)(Nc1c(I)c(C(=O)O)c(I)c(C(=O)O)c1I)OC |
| InChI | InChI=1S/C12H12I3NO6/c1-12(21-2,22-3)16-9-7(14)4(10(17)18)6(13)5(8(9)15)11(19)20/h16H,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | CLSXZRQXGJRIFZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 105.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.94 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|