C7H10N4O — CID 110691624
5-methyl-N-prop-2-enyl-2H-triazole-4-carboxamide (PubChem CID 110691624) has the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. Its IUPAC name is 5-methyl-N-prop-2-enyl-2H-triazole-4-carboxamide.
| Compound Name | 5-methyl-N-prop-2-enyl-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 110691624 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 5-methyl-N-prop-2-enyl-2H-triazole-4-carboxamide |
| SMILES | C=CCNC(=O)c1n[nH]nc1C |
| InChI | InChI=1S/C7H10N4O/c1-3-4-8-7(12)6-5(2)9-11-10-6/h3H,1,4H2,2H3,(H,8,12)(H,9,10,11) |
| InChIKey | PKYOLRPQBUNCRC-UHFFFAOYSA-N |
| XLogP | 0.03 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|