C8H15N5O — CID 6416295
N'-butan-2-yl-5-methyl-2H-triazole-4-carbohydrazide (PubChem CID 6416295) has the molecular formula C8H15N5O and a molecular weight of 197.24 g/mol. Its IUPAC name is N'-butan-2-yl-5-methyl-2H-triazole-4-carbohydrazide.
| Compound Name | N'-butan-2-yl-5-methyl-2H-triazole-4-carbohydrazide |
|---|---|
| PubChem CID | 6416295 |
| Molecular Formula | C8H15N5O |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.13 |
| IUPAC Name | N'-butan-2-yl-5-methyl-2H-triazole-4-carbohydrazide |
| SMILES | CCC(C)NNC(=O)c1n[nH]nc1C |
| InChI | InChI=1S/C8H15N5O/c1-4-5(2)9-12-8(14)7-6(3)10-13-11-7/h5,9H,4H2,1-3H3,(H,12,14)(H,10,11,13) |
| InChIKey | ZHJLEBDNQJMDET-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|