C25H16I3NOS2 — CID 46501325
N-[3,5-bis(phenylsulfanyl)phenyl]-2,3,5-triiodobenzamide (PubChem CID 46501325) has the molecular formula C25H16I3NOS2 and a molecular weight of 791.25 g/mol. Its IUPAC name is N-[3,5-bis(phenylsulfanyl)phenyl]-2,3,5-triiodobenzamide.
| Compound Name | N-[3,5-bis(phenylsulfanyl)phenyl]-2,3,5-triiodobenzamide |
|---|---|
| PubChem CID | 46501325 |
| Molecular Formula | C25H16I3NOS2 |
| Molecular Weight | 791.25 g/mol |
| Exact Mass | 790.78 |
| IUPAC Name | N-[3,5-bis(phenylsulfanyl)phenyl]-2,3,5-triiodobenzamide |
| SMILES | O=C(Nc1cc(Sc2ccccc2)cc(Sc2ccccc2)c1)c1cc(I)cc(I)c1I |
| InChI | InChI=1S/C25H16I3NOS2/c26-16-11-22(24(28)23(27)12-16)25(30)29-17-13-20(31-18-7-3-1-4-8-18)15-21(14-17)32-19-9-5-2-6-10-19/h1-15H,(H,29,30) |
| InChIKey | DCIAQYXPXNYFHZ-UHFFFAOYSA-N |
| XLogP | 9.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.25 |
| LogP ≤ 5 | 9.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|