C19H13I2NO2 — CID 90645537
2-hydroxy-3,5-diiodo-N-(4-phenylphenyl)benzamide (PubChem CID 90645537) has the molecular formula C19H13I2NO2 and a molecular weight of 541.13 g/mol. Its IUPAC name is 2-hydroxy-3,5-diiodo-N-(4-phenylphenyl)benzamide.
| Compound Name | 2-hydroxy-3,5-diiodo-N-(4-phenylphenyl)benzamide |
|---|---|
| PubChem CID | 90645537 |
| Molecular Formula | C19H13I2NO2 |
| Molecular Weight | 541.13 g/mol |
| Exact Mass | 540.90 |
| IUPAC Name | 2-hydroxy-3,5-diiodo-N-(4-phenylphenyl)benzamide |
| SMILES | O=C(Nc1ccc(-c2ccccc2)cc1)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C19H13I2NO2/c20-14-10-16(18(23)17(21)11-14)19(24)22-15-8-6-13(7-9-15)12-4-2-1-3-5-12/h1-11,23H,(H,22,24) |
| InChIKey | IUHUYJVHOABGDI-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.13 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|