C13H7ClFI2NO2 — CID 11998244
N-(5-chloro-2-fluorophenyl)-2-hydroxy-3,5-diiodobenzamide (PubChem CID 11998244) has the molecular formula C13H7ClFI2NO2 and a molecular weight of 517.46 g/mol. Its IUPAC name is N-(5-chloro-2-fluorophenyl)-2-hydroxy-3,5-diiodobenzamide.
| Compound Name | N-(5-chloro-2-fluorophenyl)-2-hydroxy-3,5-diiodobenzamide |
|---|---|
| PubChem CID | 11998244 |
| Molecular Formula | C13H7ClFI2NO2 |
| Molecular Weight | 517.46 g/mol |
| Exact Mass | 516.82 |
| IUPAC Name | N-(5-chloro-2-fluorophenyl)-2-hydroxy-3,5-diiodobenzamide |
| SMILES | O=C(Nc1cc(Cl)ccc1F)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C13H7ClFI2NO2/c14-6-1-2-9(15)11(3-6)18-13(20)8-4-7(16)5-10(17)12(8)19/h1-5,19H,(H,18,20) |
| InChIKey | PSMAPTHBJHUKRP-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.46 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|