C22H16Cl2I2N2O3 — CID 169433203
N-[4-[2-amino-1-(4-chlorophenyl)-2-oxoethyl]-5-chloro-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide (PubChem CID 169433203) has the molecular formula C22H16Cl2I2N2O3 and a molecular weight of 681.09 g/mol. Its IUPAC name is N-[4-[2-amino-1-(4-chlorophenyl)-2-oxoethyl]-5-chloro-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide.
| Compound Name | N-[4-[2-amino-1-(4-chlorophenyl)-2-oxoethyl]-5-chloro-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide |
|---|---|
| PubChem CID | 169433203 |
| Molecular Formula | C22H16Cl2I2N2O3 |
| Molecular Weight | 681.09 g/mol |
| Exact Mass | 679.86 |
| IUPAC Name | N-[4-[2-amino-1-(4-chlorophenyl)-2-oxoethyl]-5-chloro-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide |
| SMILES | Cc1cc(C(C(N)=O)c2ccc(Cl)cc2)c(Cl)cc1NC(=O)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C22H16Cl2I2N2O3/c1-10-6-14(19(21(27)30)11-2-4-12(23)5-3-11)16(24)9-18(10)28-22(31)15-7-13(25)8-17(26)20(15)29/h2-9,19,29H,1H3,(H2,27,30)(H,28,31) |
| InChIKey | ABAOHANPTJAASG-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 92.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.09 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|