C23H18ClFN2O2S — CID 157249814
N-[5-chloro-4-[cyano-(4-methylphenyl)methyl]-2-methylphenyl]-4-fluoro-3-hydroxy-2-sulfanylbenzamide (PubChem CID 157249814) has the molecular formula C23H18ClFN2O2S and a molecular weight of 440.93 g/mol. Its IUPAC name is N-[5-chloro-4-[cyano-(4-methylphenyl)methyl]-2-methylphenyl]-4-fluoro-3-hydroxy-2-sulfanylbenzamide.
| Compound Name | N-[5-chloro-4-[cyano-(4-methylphenyl)methyl]-2-methylphenyl]-4-fluoro-3-hydroxy-2-sulfanylbenzamide |
|---|---|
| PubChem CID | 157249814 |
| Molecular Formula | C23H18ClFN2O2S |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.08 |
| IUPAC Name | N-[5-chloro-4-[cyano-(4-methylphenyl)methyl]-2-methylphenyl]-4-fluoro-3-hydroxy-2-sulfanylbenzamide |
| SMILES | Cc1ccc(C(C#N)c2cc(C)c(NC(=O)c3ccc(F)c(O)c3S)cc2Cl)cc1 |
| InChI | InChI=1S/C23H18ClFN2O2S/c1-12-3-5-14(6-4-12)17(11-26)16-9-13(2)20(10-18(16)24)27-23(29)15-7-8-19(25)21(28)22(15)30/h3-10,17,28,30H,1-2H3,(H,27,29) |
| InChIKey | AFOXJMYXLRJAJJ-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|