C16H14Cl2N2O2S — CID 17381718
N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]methanesulfonamide (PubChem CID 17381718) has the molecular formula C16H14Cl2N2O2S and a molecular weight of 369.27 g/mol. Its IUPAC name is N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]methanesulfonamide.
| Compound Name | N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]methanesulfonamide |
|---|---|
| PubChem CID | 17381718 |
| Molecular Formula | C16H14Cl2N2O2S |
| Molecular Weight | 369.27 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]methanesulfonamide |
| SMILES | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1NS(C)(=O)=O |
| InChI | InChI=1S/C16H14Cl2N2O2S/c1-10-7-13(15(18)8-16(10)20-23(2,21)22)14(9-19)11-3-5-12(17)6-4-11/h3-8,14,20H,1-2H3 |
| InChIKey | INLGRHHWGYWXGT-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.27 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |