C18H15Cl3N2O — CID 94830986
3-chloro-N-[5-chloro-4-[(R)-(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]propanamide (PubChem CID 94830986) has the molecular formula C18H15Cl3N2O and a molecular weight of 381.69 g/mol. Its IUPAC name is 3-chloro-N-[5-chloro-4-[(R)-(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]propanamide.
| Compound Name | 3-chloro-N-[5-chloro-4-[(R)-(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]propanamide |
|---|---|
| PubChem CID | 94830986 |
| Molecular Formula | C18H15Cl3N2O |
| Molecular Weight | 381.69 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | 3-chloro-N-[5-chloro-4-[(R)-(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]propanamide |
| SMILES | Cc1cc([C@H](C#N)c2ccc(Cl)cc2)c(Cl)cc1NC(=O)CCCl |
| InChI | InChI=1S/C18H15Cl3N2O/c1-11-8-14(15(10-22)12-2-4-13(20)5-3-12)16(21)9-17(11)23-18(24)6-7-19/h2-5,8-9,15H,6-7H2,1H3,(H,23,24)/t15-/m1/s1 |
| InChIKey | UNOCIOGZZARBGF-OAHLLOKOSA-N |
| XLogP | 5.52 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.69 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|