C22H17Cl2N3S — CID 4225828
1-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-3-phenylthiourea (PubChem CID 4225828) has the molecular formula C22H17Cl2N3S and a molecular weight of 426.37 g/mol. Its IUPAC name is 1-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-3-phenylthiourea.
| Compound Name | 1-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-3-phenylthiourea |
|---|---|
| PubChem CID | 4225828 |
| Molecular Formula | C22H17Cl2N3S |
| Molecular Weight | 426.37 g/mol |
| Exact Mass | 425.05 |
| IUPAC Name | 1-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-3-phenylthiourea |
| SMILES | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1NC(=S)Nc1ccccc1 |
| InChI | InChI=1S/C22H17Cl2N3S/c1-14-11-18(19(13-25)15-7-9-16(23)10-8-15)20(24)12-21(14)27-22(28)26-17-5-3-2-4-6-17/h2-12,19H,1H3,(H2,26,27,28) |
| InChIKey | HFAPXJGJRKJOFS-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 47.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.37 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|