C19H19Cl2N — CID 153315431
2-(4-tert-butyl-2-chloro-5-methylphenyl)-2-(4-chlorophenyl)acetonitrile (PubChem CID 153315431) has the molecular formula C19H19Cl2N and a molecular weight of 332.27 g/mol. Its IUPAC name is 2-(4-tert-butyl-2-chloro-5-methylphenyl)-2-(4-chlorophenyl)acetonitrile.
| Compound Name | 2-(4-tert-butyl-2-chloro-5-methylphenyl)-2-(4-chlorophenyl)acetonitrile |
|---|---|
| PubChem CID | 153315431 |
| Molecular Formula | C19H19Cl2N |
| Molecular Weight | 332.27 g/mol |
| Exact Mass | 331.09 |
| IUPAC Name | 2-(4-tert-butyl-2-chloro-5-methylphenyl)-2-(4-chlorophenyl)acetonitrile |
| SMILES | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1C(C)(C)C |
| InChI | InChI=1S/C19H19Cl2N/c1-12-9-15(18(21)10-17(12)19(2,3)4)16(11-22)13-5-7-14(20)8-6-13/h5-10,16H,1-4H3 |
| InChIKey | HIEBZNUDKINXJU-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.27 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |