C25H22Cl2N2O3S — CID 17224971
N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-propylsulfonylbenzamide (PubChem CID 17224971) has the molecular formula C25H22Cl2N2O3S and a molecular weight of 501.44 g/mol. Its IUPAC name is N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-propylsulfonylbenzamide.
| Compound Name | N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-propylsulfonylbenzamide |
|---|---|
| PubChem CID | 17224971 |
| Molecular Formula | C25H22Cl2N2O3S |
| Molecular Weight | 501.44 g/mol |
| Exact Mass | 500.07 |
| IUPAC Name | N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-propylsulfonylbenzamide |
| SMILES | CCCS(=O)(=O)c1ccccc1C(=O)Nc1cc(Cl)c(C(C#N)c2ccc(Cl)cc2)cc1C |
| InChI | InChI=1S/C25H22Cl2N2O3S/c1-3-12-33(31,32)24-7-5-4-6-19(24)25(30)29-23-14-22(27)20(13-16(23)2)21(15-28)17-8-10-18(26)11-9-17/h4-11,13-14,21H,3,12H2,1-2H3,(H,29,30) |
| InChIKey | QHKDQMDMZGCRDV-UHFFFAOYSA-N |
| XLogP | 6.39 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.44 |
| LogP ≤ 5 | 6.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |