C24H20Cl2N4O5S — CID 17193011
N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-3-[(4-nitrophenyl)sulfonylamino]propanamide (PubChem CID 17193011) has the molecular formula C24H20Cl2N4O5S and a molecular weight of 547.42 g/mol. Its IUPAC name is N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-3-[(4-nitrophenyl)sulfonylamino]propanamide.
| Compound Name | N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-3-[(4-nitrophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 17193011 |
| Molecular Formula | C24H20Cl2N4O5S |
| Molecular Weight | 547.42 g/mol |
| Exact Mass | 546.05 |
| IUPAC Name | N-[5-chloro-4-[(4-chlorophenyl)-cyanomethyl]-2-methylphenyl]-3-[(4-nitrophenyl)sulfonylamino]propanamide |
| SMILES | Cc1cc(C(C#N)c2ccc(Cl)cc2)c(Cl)cc1NC(=O)CCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H20Cl2N4O5S/c1-15-12-20(21(14-27)16-2-4-17(25)5-3-16)22(26)13-23(15)29-24(31)10-11-28-36(34,35)19-8-6-18(7-9-19)30(32)33/h2-9,12-13,21,28H,10-11H2,1H3,(H,29,31) |
| InChIKey | HJQVSYQSYBOBCA-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 142.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.42 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|