C17H19N3O7S — CID 17192805
N-(2,4-dimethoxyphenyl)-3-[(4-nitrophenyl)sulfonylamino]propanamide (PubChem CID 17192805) has the molecular formula C17H19N3O7S and a molecular weight of 409.42 g/mol. Its IUPAC name is N-(2,4-dimethoxyphenyl)-3-[(4-nitrophenyl)sulfonylamino]propanamide.
| Compound Name | N-(2,4-dimethoxyphenyl)-3-[(4-nitrophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 17192805 |
| Molecular Formula | C17H19N3O7S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.09 |
| IUPAC Name | N-(2,4-dimethoxyphenyl)-3-[(4-nitrophenyl)sulfonylamino]propanamide |
| SMILES | COc1ccc(NC(=O)CCNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c(OC)c1 |
| InChI | InChI=1S/C17H19N3O7S/c1-26-13-5-8-15(16(11-13)27-2)19-17(21)9-10-18-28(24,25)14-6-3-12(4-7-14)20(22)23/h3-8,11,18H,9-10H2,1-2H3,(H,19,21) |
| InChIKey | XRMTVZPUDZYTMT-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|