C19H19N5O6S2 — CID 17192977
N-[5-[(4-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-3-[(4-nitrophenyl)sulfonylamino]propanamide (PubChem CID 17192977) has the molecular formula C19H19N5O6S2 and a molecular weight of 477.52 g/mol. Its IUPAC name is N-[5-[(4-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-3-[(4-nitrophenyl)sulfonylamino]propanamide.
| Compound Name | N-[5-[(4-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-3-[(4-nitrophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 17192977 |
| Molecular Formula | C19H19N5O6S2 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.08 |
| IUPAC Name | N-[5-[(4-methoxyphenyl)methyl]-1,3,4-thiadiazol-2-yl]-3-[(4-nitrophenyl)sulfonylamino]propanamide |
| SMILES | COc1ccc(Cc2nnc(NC(=O)CCNS(=O)(=O)c3ccc([N+](=O)[O-])cc3)s2)cc1 |
| InChI | InChI=1S/C19H19N5O6S2/c1-30-15-6-2-13(3-7-15)12-18-22-23-19(31-18)21-17(25)10-11-20-32(28,29)16-8-4-14(5-9-16)24(26)27/h2-9,20H,10-12H2,1H3,(H,21,23,25) |
| InChIKey | FKSLLMHKYZANIC-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 153.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|