C16H16N4O8S — CID 17192871
N-(4-methoxy-2-nitrophenyl)-3-[(4-nitrophenyl)sulfonylamino]propanamide (PubChem CID 17192871) has the molecular formula C16H16N4O8S and a molecular weight of 424.39 g/mol. Its IUPAC name is N-(4-methoxy-2-nitrophenyl)-3-[(4-nitrophenyl)sulfonylamino]propanamide.
| Compound Name | N-(4-methoxy-2-nitrophenyl)-3-[(4-nitrophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 17192871 |
| Molecular Formula | C16H16N4O8S |
| Molecular Weight | 424.39 g/mol |
| Exact Mass | 424.07 |
| IUPAC Name | N-(4-methoxy-2-nitrophenyl)-3-[(4-nitrophenyl)sulfonylamino]propanamide |
| SMILES | COc1ccc(NC(=O)CCNS(=O)(=O)c2ccc([N+](=O)[O-])cc2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H16N4O8S/c1-28-12-4-7-14(15(10-12)20(24)25)18-16(21)8-9-17-29(26,27)13-5-2-11(3-6-13)19(22)23/h2-7,10,17H,8-9H2,1H3,(H,18,21) |
| InChIKey | LZXYFJSXYIEDGJ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 170.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.39 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|