C22H14Cl2I2N2O2 — CID 126963491
N-[5-chloro-4-[(2-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide (PubChem CID 126963491) has the molecular formula C22H14Cl2I2N2O2 and a molecular weight of 663.08 g/mol. Its IUPAC name is N-[5-chloro-4-[(2-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide.
| Compound Name | N-[5-chloro-4-[(2-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide |
|---|---|
| PubChem CID | 126963491 |
| Molecular Formula | C22H14Cl2I2N2O2 |
| Molecular Weight | 663.08 g/mol |
| Exact Mass | 661.85 |
| IUPAC Name | N-[5-chloro-4-[(2-chlorophenyl)-cyanomethyl]-2-methylphenyl]-2-hydroxy-3,5-diiodobenzamide |
| SMILES | Cc1cc(C(C#N)c2ccccc2Cl)c(Cl)cc1NC(=O)c1cc(I)cc(I)c1O |
| InChI | InChI=1S/C22H14Cl2I2N2O2/c1-11-6-14(16(10-27)13-4-2-3-5-17(13)23)18(24)9-20(11)28-22(30)15-7-12(25)8-19(26)21(15)29/h2-9,16,29H,1H3,(H,28,30) |
| InChIKey | IZOATLSSZMYSHH-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 73.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.08 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|