C23H17Cl2I2NO4 — CID 169443507
methyl 2-[2-chloro-4-[(2-hydroxy-3,5-diiodobenzoyl)amino]-5-methylphenyl]-2-(4-chlorophenyl)acetate (PubChem CID 169443507) has the molecular formula C23H17Cl2I2NO4 and a molecular weight of 696.11 g/mol. Its IUPAC name is methyl 2-[2-chloro-4-[(2-hydroxy-3,5-diiodobenzoyl)amino]-5-methylphenyl]-2-(4-chlorophenyl)acetate.
| Compound Name | methyl 2-[2-chloro-4-[(2-hydroxy-3,5-diiodobenzoyl)amino]-5-methylphenyl]-2-(4-chlorophenyl)acetate |
|---|---|
| PubChem CID | 169443507 |
| Molecular Formula | C23H17Cl2I2NO4 |
| Molecular Weight | 696.11 g/mol |
| Exact Mass | 694.86 |
| IUPAC Name | methyl 2-[2-chloro-4-[(2-hydroxy-3,5-diiodobenzoyl)amino]-5-methylphenyl]-2-(4-chlorophenyl)acetate |
| SMILES | COC(=O)C(c1ccc(Cl)cc1)c1cc(C)c(NC(=O)c2cc(I)cc(I)c2O)cc1Cl |
| InChI | InChI=1S/C23H17Cl2I2NO4/c1-11-7-15(20(23(31)32-2)12-3-5-13(24)6-4-12)17(25)10-19(11)28-22(30)16-8-14(26)9-18(27)21(16)29/h3-10,20,29H,1-2H3,(H,28,30) |
| InChIKey | HNHUJXLFEICJDH-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.11 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|