C14H22N4O2 — CID 139234600
3-N,6-N-ditert-butylpyridazine-3,6-dicarboxamide (PubChem CID 139234600) has the molecular formula C14H22N4O2 and a molecular weight of 278.36 g/mol. Its IUPAC name is 3-N,6-N-ditert-butylpyridazine-3,6-dicarboxamide.
| Compound Name | 3-N,6-N-ditert-butylpyridazine-3,6-dicarboxamide |
|---|---|
| PubChem CID | 139234600 |
| Molecular Formula | C14H22N4O2 |
| Molecular Weight | 278.36 g/mol |
| Exact Mass | 278.17 |
| IUPAC Name | 3-N,6-N-ditert-butylpyridazine-3,6-dicarboxamide |
| SMILES | CC(C)(C)NC(=O)c1ccc(C(=O)NC(C)(C)C)nn1 |
| InChI | InChI=1S/C14H22N4O2/c1-13(2,3)15-11(19)9-7-8-10(18-17-9)12(20)16-14(4,5)6/h7-8H,1-6H3,(H,15,19)(H,16,20) |
| InChIKey | ZEWMNEUIBQNZIP-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |