C27H41IN2O4Si — CID 70149228
N-[4-[2-(3-tripropoxysilylpropylamino)phenyl]phenyl]prop-2-enamide;hydroiodide (PubChem CID 70149228) has the molecular formula C27H41IN2O4Si and a molecular weight of 612.63 g/mol. Its IUPAC name is N-[4-[2-(3-tripropoxysilylpropylamino)phenyl]phenyl]prop-2-enamide;hydroiodide.
| Compound Name | N-[4-[2-(3-tripropoxysilylpropylamino)phenyl]phenyl]prop-2-enamide;hydroiodide |
|---|---|
| PubChem CID | 70149228 |
| Molecular Formula | C27H41IN2O4Si |
| Molecular Weight | 612.63 g/mol |
| Exact Mass | 612.19 |
| IUPAC Name | N-[4-[2-(3-tripropoxysilylpropylamino)phenyl]phenyl]prop-2-enamide;hydroiodide |
| SMILES | C=CC(=O)Nc1ccc(-c2ccccc2NCCC[Si](OCCC)(OCCC)OCCC)cc1.I |
| InChI | InChI=1S/C27H40N2O4Si.HI/c1-5-19-31-34(32-20-6-2,33-21-7-3)22-11-18-28-26-13-10-9-12-25(26)23-14-16-24(17-15-23)29-27(30)8-4;/h8-10,12-17,28H,4-7,11,18-22H2,1-3H3,(H,29,30);1H |
| InChIKey | VVZXKVBIYVMIAG-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.63 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|