C14H24F3NO5Si3 — CID 123770092
3,3,3-trifluoro-N-[3-[hydroperoxy-[hydroxy(methyl)silyl]silyloxy-methylsilyl]propyl]-N-phenylpropanamide (PubChem CID 123770092) has the molecular formula C14H24F3NO5Si3 and a molecular weight of 427.60 g/mol. Its IUPAC name is 3,3,3-trifluoro-N-[3-[hydroperoxy-[hydroxy(methyl)silyl]silyloxy-methylsilyl]propyl]-N-phenylpropanamide.
| Compound Name | 3,3,3-trifluoro-N-[3-[hydroperoxy-[hydroxy(methyl)silyl]silyloxy-methylsilyl]propyl]-N-phenylpropanamide |
|---|---|
| PubChem CID | 123770092 |
| Molecular Formula | C14H24F3NO5Si3 |
| Molecular Weight | 427.60 g/mol |
| Exact Mass | 427.09 |
| IUPAC Name | 3,3,3-trifluoro-N-[3-[hydroperoxy-[hydroxy(methyl)silyl]silyloxy-methylsilyl]propyl]-N-phenylpropanamide |
| SMILES | C[SiH](O)[SiH2]O[Si](C)(CCCN(C(=O)CC(F)(F)F)c1ccccc1)OO |
| InChI | InChI=1S/C14H24F3NO5Si3/c1-25(21)24-23-26(2,22-20)10-6-9-18(12-7-4-3-5-8-12)13(19)11-14(15,16)17/h3-5,7-8,20-21,25H,6,9-11,24H2,1-2H3 |
| InChIKey | YFZAICPWKGCVIN-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.60 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|