C13H17F3N2O2 — CID 103205322
N-(3-aminopropyl)-N-phenyl-2-(2,2,2-trifluoroethoxy)acetamide (PubChem CID 103205322) has the molecular formula C13H17F3N2O2 and a molecular weight of 290.29 g/mol. Its IUPAC name is N-(3-aminopropyl)-N-phenyl-2-(2,2,2-trifluoroethoxy)acetamide.
| Compound Name | N-(3-aminopropyl)-N-phenyl-2-(2,2,2-trifluoroethoxy)acetamide |
|---|---|
| PubChem CID | 103205322 |
| Molecular Formula | C13H17F3N2O2 |
| Molecular Weight | 290.29 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | N-(3-aminopropyl)-N-phenyl-2-(2,2,2-trifluoroethoxy)acetamide |
| SMILES | NCCCN(C(=O)COCC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C13H17F3N2O2/c14-13(15,16)10-20-9-12(19)18(8-4-7-17)11-5-2-1-3-6-11/h1-3,5-6H,4,7-10,17H2 |
| InChIKey | AOKZIRIMBLKOCO-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |