C18H23ClN4O2 — CID 22452892
tert-butyl N-[2-[(3-amino-2-pyridinyl)amino]ethyl]-N-(4-chlorophenyl)carbamate (PubChem CID 22452892) has the molecular formula C18H23ClN4O2 and a molecular weight of 362.86 g/mol. Its IUPAC name is tert-butyl N-[2-[(3-amino-2-pyridinyl)amino]ethyl]-N-(4-chlorophenyl)carbamate.
| Compound Name | tert-butyl N-[2-[(3-amino-2-pyridinyl)amino]ethyl]-N-(4-chlorophenyl)carbamate |
|---|---|
| PubChem CID | 22452892 |
| Molecular Formula | C18H23ClN4O2 |
| Molecular Weight | 362.86 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | tert-butyl N-[2-[(3-amino-2-pyridinyl)amino]ethyl]-N-(4-chlorophenyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCNc1ncccc1N)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H23ClN4O2/c1-18(2,3)25-17(24)23(14-8-6-13(19)7-9-14)12-11-22-16-15(20)5-4-10-21-16/h4-10H,11-12,20H2,1-3H3,(H,21,22) |
| InChIKey | XEXQPXYBCJFDRE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.86 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |