C7H10N4O — CID 14390487
2-[(3-amino-2-pyridinyl)amino]acetamide (PubChem CID 14390487) has the molecular formula C7H10N4O and a molecular weight of 166.18 g/mol. Its IUPAC name is 2-[(3-amino-2-pyridinyl)amino]acetamide.
| Compound Name | 2-[(3-amino-2-pyridinyl)amino]acetamide |
|---|---|
| PubChem CID | 14390487 |
| Molecular Formula | C7H10N4O |
| Molecular Weight | 166.18 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 2-[(3-amino-2-pyridinyl)amino]acetamide |
| SMILES | NC(=O)CNc1ncccc1N |
| InChI | InChI=1S/C7H10N4O/c8-5-2-1-3-10-7(5)11-4-6(9)12/h1-3H,4,8H2,(H2,9,12)(H,10,11) |
| InChIKey | UNXDGGNIROJCKS-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.18 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |